![[3-(2-methylpropoxy)phenyl]boronic acid (CAS: 849052-21-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0741566.png "[3-(2-methylpropoxy)phenyl]boronic acid chemical structure")
[3-(2-methylpropoxy)phenyl]boronic acid
Catalog No: FT-0741566
CAS No: 849052-21-7
- Chemical Name: [3-(2-methylpropoxy)phenyl]boronic acid
- Molecular Formula: C10H15BO3
- Molecular Weight: 194.04
- InChI Key: TZOSYEUNKIDTBY-UHFFFAOYSA-N
- InChI: InChI=1S/C10H15BO3/c1-8(2)7-14-10-5-3-4-9(6-10)11(12)13/h3-6,8,12-13H,7H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 849052-21-7 |
|---|---|
| MF: | C10H15BO3 |
| Density: | 1.08g/cm3 |
| Flash_Point: | 161.9ºC |
| Melting_Point: | 90-95ºC(lit.) |
| Product_Name: | [3-(2-methylpropoxy)phenyl]boronic acid |
| Symbol: | GHS07 |
| Bolling_Point: | 344ºC at 760 mmHg |
| FW: | 194.03500 |
| Density: | 1.08g/cm3 |
|---|---|
| MF: | C10H15BO3 |
| LogP: | 0.40120 |
| Melting_Point: | 90-95ºC(lit.) |
| Exact_Mass: | 194.11100 |
| Bolling_Point: | 344ºC at 760 mmHg |
| Flash_Point: | 161.9ºC |
| FW: | 194.03500 |
| Refractive_Index: | 1.508 |
| PSA: | 49.69000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | 26-36 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2931900090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | 36/37/38 |
